TCO-pnb ester, 95% rel-(1R-4E-pS)-axial
cas: 2389122-16-9 — see every product listed under this CAS number, including other names
TCO-pnb ester, 95% rel-(1R-4E-pS)-axial (CAS 2389122-16-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A760780-100mg |
| cas | 2389122-16-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1471.75 Pln | |
| Ambeed | 250mg | 2595.38 Pln | |
| Ambeed | 1g | 7334.62 Pln | |
| Ambeed | 5g | 29117.38 Pln | |
| BLDpharm | 50mg | 958.58 Pln | |
| BLDpharm | 100mg | 1580.58 Pln | |
| BLDpharm | 250mg | 2791.26 Pln | |
| BLDpharm | 1g | 7189.72 Pln | |
| BLDpharm | 5g | 28543.31 Pln |
properties
| purity | 95% rel-(1R-4E-pS)-axial |
|---|---|
| delivery time | 1-2 weeks |
Cyclooct-4-en-1-yl (4-nitrophenyl) carbonate (CAS 2389122-16-9) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: cyclooct-4-en-1-yl (4-nitrophenyl) carbonate. InChIKey: FJMMADPCDJNXAH-UHFFFAOYSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | cyclooct-4-en-1-yl (4-nitrophenyl) carbonate |
| InChIKey | FJMMADPCDJNXAH-UHFFFAOYSA-N |
| SMILES | C1CC=CCCC(C1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
