Products 1354323-64-0
CAS 1354323-64-0 appears in our catalog under these names: rel-(1R-4E-pR)-Cyclooct-4-en-1-yl (4-nitrophenyl) carbonate, 95%, 95%, rel-(1R-4E-pR)-Cyclooct-4-en-1-yl (4-nitrophenyl) carbonate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Cyclooct-4-en-1-yl (4-nitrophenyl) carbonate (CAS 1354323-64-0) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: cyclooct-4-en-1-yl (4-nitrophenyl) carbonate. InChIKey: FJMMADPCDJNXAH-UHFFFAOYSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | cyclooct-4-en-1-yl (4-nitrophenyl) carbonate |
| InChIKey | FJMMADPCDJNXAH-UHFFFAOYSA-N |
| SMILES | C1CC=CCCC(C1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)