CAS 1438415-89-4 appears in our catalog under these names: (R,E)-Cyclooct-4-en-1-yl (4-nitrophenyl) carbonate, 98%, TCO-Pnb ester, 98%, TCO–PNB ester, TCO-PNB ester 98% + rel-(1R-4E-pR)-equatorial, TCO-PNB ESTER. Offered by: Fluorochem, Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 50mg, 100mg, 250mg, 1g, 50 mg, 25 mg, 100 mg.
[(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate (CAS 1438415-89-4) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate. InChIKey: FJMMADPCDJNXAH-UPHRSURJSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(4Z)-cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate |
| InChIKey | FJMMADPCDJNXAH-UPHRSURJSA-N |
| SMILES | C1C/C=C\CCC(C1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)