TERT-BUTYL 3,5-DINITROBENZOATE, 98%
cas: 5342-97-2 — see every product listed under this CAS number, including other names
TERT-BUTYL 3,5-DINITROBENZOATE, 98% (CAS 5342-97-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F333890-250MG |
| cas | 5342-97-2 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 1903.51 Pln | |
| Fluorochem | 10g | 3017.71 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 809.81 Pln | |
| Ambeed | 5g | 1855.56 Pln | |
| Ambeed | 10g | 2929.12 Pln | |
| BLDpharm | 250mg | 508.73 Pln | |
| BLDpharm | 1g | 791.97 Pln | |
| BLDpharm | 5g | 1813.83 Pln | |
| BLDpharm | 10g | 2863.46 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 3,5-dinitrobenzoate (CAS 5342-97-2) is a chemical compound with the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. IUPAC name: tert-butyl 3,5-dinitrobenzoate. InChIKey: JETCTPYQTQUQPA-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | tert-butyl 3,5-dinitrobenzoate |
| InChIKey | JETCTPYQTQUQPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1,1-Dimethylethyl 3,5-dinitrobenzoate, tert-butyl 3,5-dinitrobenzoate, 3,5-dinitro-benzoic acid tert-butyl ester, t-butyl 3,5-dinitrobenzoate, Benzoic acid,3,5-dinitro-, 1,1-dimethylethyl ester, Benzoic acid, 3,5-dinitro-, 1,1-dimethylethyl ester, Benzoic acid,5-dinitro-, 1,1-dimethylethyl ester