cas: 129487-99-6 — see every product listed under this CAS number, including other names
TERT-BUTYL 6-NITROINDOLINE-1-CARBOXYLATE, 97% (CAS 129487-99-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387570-100MG |
| cas | 129487-99-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 747.67 Pln | |
| Fluorochem | 1g | 1783.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 6-nitro-2,3-dihydroindole-1-carboxylate (CAS 129487-99-6) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: tert-butyl 6-nitro-2,3-dihydroindole-1-carboxylate. InChIKey: WZRINQCGMYWFFT-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | tert-butyl 6-nitro-2,3-dihydroindole-1-carboxylate |
| InChIKey | WZRINQCGMYWFFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)