cas: 480424-71-3 — see every product listed under this CAS number, including other names
Tert-Butyl (2-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl) Carbonate, 98%, 98% (CAS 480424-71-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9R4-500mg |
| cas | 480424-71-3 |
| size | 500mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 160.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 760.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate (CAS 480424-71-3) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate. InChIKey: JWSZKSKLMRKJHM-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate |
| InChIKey | JWSZKSKLMRKJHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)