CAS 2724208-38-0 appears in our catalog under these names: 3-[4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl acetate, 95%, 3-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl acetate, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g.
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl acetate (CAS 2724208-38-0) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl acetate. InChIKey: HSYUPQDYVFVDMN-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl acetate |
| InChIKey | HSYUPQDYVFVDMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCOC(=O)C |
Computed by PubChem (NCBI)