CAS 480438-74-2 appears in our catalog under these names: 3–(tert–Butoxycarbonyloxy)phenylboronic acid pinacol ester, tert-Butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxa-borolan-2-yl) phenyl carbonate, 95+%, 95+%, tert-Butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxa-borolan-2-yl) phenyl carbonate, 95%, tert-Butyl (3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl) carbonate, 95+%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
Tert-butyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate (CAS 480438-74-2) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: tert-butyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate. InChIKey: UPAKXEPDVAHKPP-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | tert-butyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate |
| InChIKey | UPAKXEPDVAHKPP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)