CAS 1887769-37-0 is the registry number for Ethyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propanoate (CAS 1887769-37-0) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propanoate. InChIKey: XTEJRBPQCPRNHO-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propanoate |
| InChIKey | XTEJRBPQCPRNHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC(C)C(=O)OCC |
Computed by PubChem (NCBI)