CAS 1429323-80-7 is the registry number for 3-[3-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenoxy]-propionic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propanoate (CAS 1429323-80-7) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: ethyl 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propanoate. InChIKey: BDKKJCVUQHNXAT-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | ethyl 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propanoate |
| InChIKey | BDKKJCVUQHNXAT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCC(=O)OCC |
Computed by PubChem (NCBI)