CAS 480424-71-3 appears in our catalog under these names: 2-t-Butoxycarboxyphenylboronic acid, pinacol ester, 95%, Tert-Butyl (2-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl) Carbonate, 98%, 98%, tert-Butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxa-borolan-2-yl)phenyl carbonate, 95%, tert-Butyl (2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl) carbonate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 500mg, 250mg, 10g.
Tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate (CAS 480424-71-3) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate. InChIKey: JWSZKSKLMRKJHM-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | tert-butyl [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] carbonate |
| InChIKey | JWSZKSKLMRKJHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)