CAS 1801514-55-5 is the registry number for Methyl 3-propoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1801514-55-5) is a chemical compound with the molecular formula C17H25BO5 and a molecular weight of 320.2 g/mol. IUPAC name: methyl 3-propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: SFUXEUZNYJOENU-UHFFFAOYSA-N.
| Molecular formula | C17H25BO5 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | methyl 3-propoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | SFUXEUZNYJOENU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCCC)C(=O)OC |
Computed by PubChem (NCBI)