cas: 2098487-39-7 — see every product listed under this CAS number, including other names
Thalidomide-propargyl, 98% (CAS 2098487-39-7) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 50mg, 100mg, 25mg, 250mg, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F986397-2MG |
| cas | 2098487-39-7 |
| size | 2mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 2mg | 336.36 Pln | |
| Fluorochem | 5mg | 508.17 Pln | |
| Fluorochem | 10mg | 804.94 Pln | |
| Fluorochem | 50mg | 2418.96 Pln | |
| Fluorochem | 100mg | 3798.68 Pln | |
| Ambeed | 10mg | 209.06 Pln | |
| Ambeed | 25mg | 325.88 Pln | |
| Ambeed | 100mg | 737.50 Pln | |
| Ambeed | 250mg | 1471.75 Pln | |
| Ambeed | 1g | 4903.81 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-(2,6-dioxopiperidin-3-yl)-4-prop-2-ynoxyisoindole-1,3-dione (CAS 2098487-39-7) is a chemical compound with the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-4-prop-2-ynoxyisoindole-1,3-dione. InChIKey: NOGQTNDSZFYNTM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O5 |
|---|---|
| Molecular weight | 312.28 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-4-prop-2-ynoxyisoindole-1,3-dione |
| InChIKey | NOGQTNDSZFYNTM-UHFFFAOYSA-N |
| SMILES | C#CCOC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)