CAS 1600515-49-8 appears in our catalog under these names: Tilfrinib/ 99.73% (existing batch purity), Tilfrinib, Tilfrinib 98%, Tilfrinib, 98%, 98%, Tilfrinib, 99.39%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
3-(9H-pyrido[2,3-b]indol-4-ylamino)phenol (CAS 1600515-49-8) is a chemical compound with the molecular formula C17H13N3O and a molecular weight of 275.30 g/mol. IUPAC name: 3-(9H-pyrido[2,3-b]indol-4-ylamino)phenol. InChIKey: RXPZOSHFGJWSLQ-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 3-(9H-pyrido[2,3-b]indol-4-ylamino)phenol |
| InChIKey | RXPZOSHFGJWSLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CN=C3N2)NC4=CC(=CC=C4)O |
Computed by PubChem (NCBI)