cas: 620-40-6 — see every product listed under this CAS number, including other names
Tribenzylamine, >99.0%(GC)(T) (CAS 620-40-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0341-25G |
| cas | 620-40-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 98.68 Pln | |
| TCI | 500g | 570.73 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC)(T) |
N,N-dibenzyl-1-phenylmethanamine (CAS 620-40-6) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: N,N-dibenzyl-1-phenylmethanamine. InChIKey: MXHTZQSKTCCMFG-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | N,N-dibenzyl-1-phenylmethanamine |
| InChIKey | MXHTZQSKTCCMFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)