CAS 603134-65-2 appears in our catalog under these names: 2,4,6-Trimethyl-N,N-diphenylaniline, 95+%, 2,4,6–Trimethyl–N,N–diphenylaniline, 2,4,6-Trimethyl-N,N-diphenylaniline, >99%(HPLC), Sublimed, >99%(HPLC), Sublimed. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 50mg.
2,4,6-trimethyl-N,N-diphenylaniline (CAS 603134-65-2) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: 2,4,6-trimethyl-N,N-diphenylaniline. InChIKey: TZJRFZZCRASCAW-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2,4,6-trimethyl-N,N-diphenylaniline |
| InChIKey | TZJRFZZCRASCAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N(C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)