Products 94964-58-6
CAS 94964-58-6 appears in our catalog under these names: (R)-(+)-1-BENZYL-2,2-DIPHENYLETHYLAMINE&, (R)-(+)-1-Benzyl-2,2-diphenylethylamine, ≥95%, ≥95%. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 500MG, 100mg.
(2R)-1,1,3-triphenylpropan-2-amine (CAS 94964-58-6) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: (2R)-1,1,3-triphenylpropan-2-amine. InChIKey: HPRWGZYKYRRJNU-HXUWFJFHSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (2R)-1,1,3-triphenylpropan-2-amine |
| InChIKey | HPRWGZYKYRRJNU-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(C2=CC=CC=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)