CAS 1333317-99-9 appears in our catalog under these names: Poly[bis(4-phenyl)(2,4,6-trimethylphenyl)amine], GPC, Poly((9,9-dioctylfluorenyl-2,7-diyl)-alt-(9-hexyl-3,6-carbazole)), Poly(bis(4–?phenyl)?(2,4,6–?trimethylphenyl)?amine), Poly(bis(4–phenyl)(2,4,6–trimethylphenyl)amine), PTAA. Offered by: Lumtec, GLPBio, TCI, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 5g, On request, 250mg, 50mg, 100mg, 25mg, 500mg.
2,4,6-trimethyl-N,N-diphenylaniline (CAS 1333317-99-9) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: 2,4,6-trimethyl-N,N-diphenylaniline. InChIKey: TZJRFZZCRASCAW-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2,4,6-trimethyl-N,N-diphenylaniline |
| InChIKey | TZJRFZZCRASCAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N(C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)