CAS 332177-83-0 appears in our catalog under these names: 4-(tert-Butyl)-2,6-diphenylpyridine 95%, 4-(tert-Butyl)-2,6-diphenylpyridine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-tert-butyl-2,6-diphenylpyridine (CAS 332177-83-0) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: 4-tert-butyl-2,6-diphenylpyridine. InChIKey: PRFHFFGLMJFIKT-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 4-tert-butyl-2,6-diphenylpyridine |
| InChIKey | PRFHFFGLMJFIKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC(=C1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)