CAS 13865-57-1 is the registry number for 4-Benzhydryl-N,N-dimethylaniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
4-benzhydryl-N,N-dimethylaniline (CAS 13865-57-1) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: 4-benzhydryl-N,N-dimethylaniline. InChIKey: CMWPUDHQIUJSCD-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 4-benzhydryl-N,N-dimethylaniline |
| InChIKey | CMWPUDHQIUJSCD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)