Products 233772-38-8
CAS 233772-38-8 appears in our catalog under these names: (S)-(-)-1-Benzyl-2,2-diphenylethylamine, 98%, 98%, (s)-1,1,3-Triphenylpropan-2-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(2S)-1,1,3-triphenylpropan-2-amine (CAS 233772-38-8) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: (2S)-1,1,3-triphenylpropan-2-amine. InChIKey: HPRWGZYKYRRJNU-FQEVSTJZSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (2S)-1,1,3-triphenylpropan-2-amine |
| InChIKey | HPRWGZYKYRRJNU-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(C2=CC=CC=C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)