CAS 1333111-40-2 appears in our catalog under these names: UBP710/ 98.39% (existing batch purity), 9-Cyclopropyl-3-phenanthrenecarboxylic acid, UBP710. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
9-cyclopropylphenanthrene-3-carboxylic acid (CAS 1333111-40-2) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: 9-cyclopropylphenanthrene-3-carboxylic acid. InChIKey: OUWRRDKZWBVAHB-UHFFFAOYSA-N.
| Molecular formula | C18H14O2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 9-cyclopropylphenanthrene-3-carboxylic acid |
| InChIKey | OUWRRDKZWBVAHB-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC3=C(C=C(C=C3)C(=O)O)C4=CC=CC=C42 |
Computed by PubChem (NCBI)