CAS 71109-09-6 appears in our catalog under these names: Vedaprofen, Vedaprofen 100 µg/mL in Acetonitrile, Vedaprofen/ 98.12% (existing batch purity), Vedaprofen 98%, VEDAPROFEN (RACEMAT) VETRANAL.. Offered by: TRC, Dr. Ehrenstorfer, TargetMol, GLPBio, Ambeed. Available pack sizes: 10mg, 25mg, 5mg, 1ml, 1mg, 50mg, 100mg, 10mM (in 1ml dmso).
2-(4-cyclohexylnaphthalen-1-yl)propanoic acid (CAS 71109-09-6) is a chemical compound with the molecular formula C19H22O2 and a molecular weight of 282.4 g/mol. IUPAC name: 2-(4-cyclohexylnaphthalen-1-yl)propanoic acid. InChIKey: VZUGVMQFWFVFBX-UHFFFAOYSA-N.
| Molecular formula | C19H22O2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 2-(4-cyclohexylnaphthalen-1-yl)propanoic acid |
| InChIKey | VZUGVMQFWFVFBX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C2=CC=CC=C21)C3CCCCC3)C(=O)O |
Computed by PubChem (NCBI)