Products 205749-56-0
CAS 205749-56-0 appears in our catalog under these names: WAY-239196/ 99.26% (existing batch purity), N1-(Furan-2-ylmethyl)-N2-phenyloxalamide. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
N-(furan-2-ylmethyl)-N'-phenyloxamide (CAS 205749-56-0) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: N-(furan-2-ylmethyl)-N'-phenyloxamide. InChIKey: RDJAFCCUSXVLGX-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-N'-phenyloxamide |
| InChIKey | RDJAFCCUSXVLGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C(=O)NCC2=CC=CO2 |
Computed by PubChem (NCBI)