Products 84392-17-6
CAS 84392-17-6 appears in our catalog under these names: Xenalipin/ 99.77% (existing batch purity), 4'–Trifluoromethyl–2–biphenyl carboxylic acid, 4'-(Trifluoromethyl)biphenyl-2-carboxylic Acid, >98.0%(GC)(T), 4'-Trifluoromethyl-2-biphenyl carboxylic acid 98%, 4'-(Trifluoromethyl)-[1，1'-biphenyl]-2-carboxylic acid, 98%, 98%. Offered by: TargetMol, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 25 g, 10 g.
2-[4-(trifluoromethyl)phenyl]benzoic acid (CAS 84392-17-6) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]benzoic acid. InChIKey: IQOMYCGTGFGDFN-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]benzoic acid |
| InChIKey | IQOMYCGTGFGDFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
XENALIPIN, 2-[4-(trifluoromethyl)phenyl]benzoic acid, Xenalipine, Xenalipina, Xenalipinum, 4'-(Trifluoromethyl)[1,1'-biphenyl]-2-carboxylic acid, (1,1'-Biphenyl)-2-carboxylic acid, 4'-(trifluoromethyl)-, 4'-Trifluoromethyl-2-biphenylcarboxylic acid, 2-(4-(trifluoromethyl)phenyl)benzoic acid, 4'-(Trifluoromethyl)(1,1'-biphenyl)-2-carboxylic acid