cas: 47087-37-6 — see every product listed under this CAS number, including other names
Z-D-Asp-OMe, 97%, 97% (CAS 47087-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DD5B-250mg |
| cas | 47087-37-6 |
| size | 250mg |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 280.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 47087-37-6) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: MFFFBNAPQRDRQW-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | MFFFBNAPQRDRQW-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)