cas: 47087-37-6 — see every product listed under this CAS number, including other names
z-d-asp-ome, 98% (CAS 47087-37-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045483-1G |
| cas | 47087-37-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 325.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 47087-37-6) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: MFFFBNAPQRDRQW-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | MFFFBNAPQRDRQW-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)