CAS 34079-31-7 appears in our catalog under these names: Z–Pro–NH2, Z-L-Pro-NH2, N-Carbobenzoxy-L-prolinamide, >98.0%(HPLC)(N), Cbz-Pro-NH2 95%, Z-Pro-NH2, 95%, 95%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
Benzyl (2S)-2-carbamoylpyrrolidine-1-carboxylate (CAS 34079-31-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl (2S)-2-carbamoylpyrrolidine-1-carboxylate. InChIKey: ZCGHEBMEQXMRQL-NSHDSACASA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl (2S)-2-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | ZCGHEBMEQXMRQL-NSHDSACASA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)