cas: 80384-27-6 — see every product listed under this CAS number, including other names
Z-D-Thr-OH, 98% (CAS 80384-27-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06270-25G |
| cas | 80384-27-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 695.61 Pln | |
| Fluorochem | 100g | 1861.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 80384-27-6) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: IPJUIRDNBFZGQN-WCBMZHEXSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | IPJUIRDNBFZGQN-WCBMZHEXSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)