cas: 21691-41-8 — see every product listed under this CAS number, including other names
Z-N-Me-Ala-OH 95% (CAS 21691-41-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A206278-250mg |
| cas | 21691-41-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A206278 |
(2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid (CAS 21691-41-8) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid. InChIKey: QGEQKVZQPWSOTI-VIFPVBQESA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | QGEQKVZQPWSOTI-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)