cas: 147900-46-7 — see every product listed under this CAS number, including other names
bis((1r,4r)-4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}cyclohexane-1-carboxylic acid), 98% (CAS 147900-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F402233-100MG |
| cas | 147900-46-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1127.75 Pln | |
| Fluorochem | 10g | 1809.80 Pln | |
| Fluorochem | 25g | 3580.01 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 147900-46-7) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: RIZQTCLNVHZQOO-UHFFFAOYSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | RIZQTCLNVHZQOO-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)