Fmoc-Trans-1,4-ACHC-OH 98%
cas: 147900-46-7 — see every product listed under this CAS number, including other names
Fmoc-Trans-1,4-ACHC-OH 98% (CAS 147900-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A385346-250mg |
| cas | 147900-46-7 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1193.62 Pln | |
| Ambeed | 10g | 1905.62 Pln | |
| Ambeed | 25g | 3763.50 Pln | |
| Ambeed | 100g | 10677.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A385346 |
4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 147900-46-7) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: RIZQTCLNVHZQOO-UHFFFAOYSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | RIZQTCLNVHZQOO-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)cyclohexane-1-carboxylic acid, Fmoc-1,4-cis-achc-oh, Fmoc-trans-4-aminocyclohexane-1-carboxylic acid, cis-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexanecarboxylic acid, Fmoc-Trans-1,4-ACHC-OH, 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic Acid, Fmoc-cis-4-aminocyclohexane-1-carboxylic acid, trans-4-(Fmoc-amino)cyclohexanecarboxylic acid, 4-(Fmoc-amino)cyclohexanecarboxylic acid, 4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}cyclohexane-1-carboxylic acid