cas: 147900-46-7 — see every product listed under this CAS number, including other names
trans-4-(Fmoc-amino)cyclohexanecarboxylic acid, 98%, 98% (CAS 147900-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112F0Z-250mg |
| cas | 147900-46-7 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 933.20 Pln | |
| Chemat | 10g | 1480.40 Pln | |
| Chemat | 25g | 2896.40 Pln | |
| Chemat | 100g | 8214.80 Pln | |
| Chemat | 100mg | 141.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 147900-46-7) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: RIZQTCLNVHZQOO-UHFFFAOYSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | RIZQTCLNVHZQOO-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)