cas: 40200-35-9 — see every product listed under this CAS number, including other names
ethyl (3-(3-tert-butyl)-4-hydroxy-5-methylphenyl)propanoate, 95%, 95% (CAS 40200-35-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AEA-25mg |
| cas | 40200-35-9 |
| size | 25mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 890.00 Pln | |
| Chemat | 100mg | 2128.40 Pln | |
| Chemat | 250mg | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate (CAS 40200-35-9) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate. InChIKey: NRKOSGXDEITTQE-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | ethyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propanoate |
| InChIKey | NRKOSGXDEITTQE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1=CC(=C(C(=C1)C)O)C(C)(C)C |
Computed by PubChem (NCBI)