cas: 160411-70-1 — see every product listed under this CAS number, including other names
ethyl 5-(4-cyanophenyl)isoxazole-3-carboxylate, 97%, 97% (CAS 160411-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13AHI8-100mg |
| cas | 160411-70-1 |
| size | 100mg |
| availability | 12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1542.80 Pln | |
| Chemat | 250mg | 3309.20 Pln | |
| Chemat | 1g | 11382.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate (CAS 160411-70-1) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate. InChIKey: KQKMMKWUFJZZEG-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | KQKMMKWUFJZZEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)