CAS 1509755-61-6 appears in our catalog under these names: 5-Methyl-1-(1-methyl-1H-pyrazol-4-yl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 5-Methyl-1-(1-methyl-1H-pyrazol-4-yl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methyl-1-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid (CAS 1509755-61-6) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: 5-methyl-1-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid. InChIKey: DLFQWAYBFBUCJM-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O2 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-methyl-1-(1-methylpyrazol-4-yl)triazole-4-carboxylic acid |
| InChIKey | DLFQWAYBFBUCJM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CN(N=C2)C)C(=O)O |
Computed by PubChem (NCBI)