CAS 1152565-70-2 appears in our catalog under these names: 1,3-Dimethyl-5-(1H-1,2,4-triazol-1-yl)-1H-pyrazole-4-carboxylic acid, 95%, 1,3-Dimethyl-5-(1H-1,2,4-triazol-1-yl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazole-4-carboxylic acid (CAS 1152565-70-2) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: 1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazole-4-carboxylic acid. InChIKey: KVLWCIJEBRVZLK-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O2 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 1,3-dimethyl-5-(1,2,4-triazol-1-yl)pyrazole-4-carboxylic acid |
| InChIKey | KVLWCIJEBRVZLK-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C(=O)O)N2C=NC=N2)C |
Computed by PubChem (NCBI)