CAS 1511044-27-1 appears in our catalog under these names: 5-Methyl-1-(1-methyl-1H-pyrazol-3-yl)-1H-1,2,3-triazole-4-carboxylic acid, 5-Methyl-1-(1-methyl-1H-pyrazol-3-yl)-1H-1,2,3-triazole-4-carboxylic acid, 98%, 5-Methyl-1-(1-methyl-1h-pyrazol-3-yl)-1h-1,2,3-triazole-4-carboxylic acid, 98%, 98%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 5g, 1g, 250mg, 100mg, 500mg.
5-methyl-1-(1-methylpyrazol-3-yl)triazole-4-carboxylic acid (CAS 1511044-27-1) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: 5-methyl-1-(1-methylpyrazol-3-yl)triazole-4-carboxylic acid. InChIKey: NHJCYFQFJPTZOZ-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O2 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-methyl-1-(1-methylpyrazol-3-yl)triazole-4-carboxylic acid |
| InChIKey | NHJCYFQFJPTZOZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=NN(C=C2)C)C(=O)O |
Computed by PubChem (NCBI)