Products 878683-87-5

CAS 878683-87-5 is the registry number for (3-Methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-ylamino)-acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]acetic acid (CAS 878683-87-5) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: 2-[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]acetic acid. InChIKey: NPPHDKAKVLGDMH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9N5O2
Molecular weight207.19 g/mol
IUPAC name2-[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]acetic acid
InChIKeyNPPHDKAKVLGDMH-UHFFFAOYSA-N
SMILESCC1=NN=C2N1N=C(C=C2)NCC(=O)O

Computed by PubChem (NCBI)