CAS 1472690-97-3 is the registry number for 4-Amino-1-methyl-N-(1,2-oxazol-4-yl)-1H-pyrazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-1-methyl-N-(1,2-oxazol-4-yl)pyrazole-3-carboxamide (CAS 1472690-97-3) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: 4-amino-1-methyl-N-(1,2-oxazol-4-yl)pyrazole-3-carboxamide. InChIKey: QUFGYDNTVSLJDC-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O2 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 4-amino-1-methyl-N-(1,2-oxazol-4-yl)pyrazole-3-carboxamide |
| InChIKey | QUFGYDNTVSLJDC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)NC2=CON=C2)N |
Computed by PubChem (NCBI)