cas: 252049-02-8 — see every product listed under this CAS number, including other names
fmoc-d-Threoninol, 98% (CAS 252049-02-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045543-250MG |
| cas | 252049-02-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1388.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-[(2S,3S)-1,3-dihydroxybutan-2-yl]carbamate (CAS 252049-02-8) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S,3S)-1,3-dihydroxybutan-2-yl]carbamate. InChIKey: YOKDHMTZJSRRIQ-SGTLLEGYSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S,3S)-1,3-dihydroxybutan-2-yl]carbamate |
| InChIKey | YOKDHMTZJSRRIQ-SGTLLEGYSA-N |
| SMILES | C[C@@H]([C@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)