cas: 721-47-1 — see every product listed under this CAS number, including other names
n-(2-Aminophenyl)benzamide (CAS 721-47-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F661187-25G |
| cas | 721-47-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 20896.83 Pln | |
| Fluorochem | 50mg | 247.85 Pln | |
| Fluorochem | 250mg | 502.97 Pln | |
| Fluorochem | 1g | 1008.00 Pln |
| delivery time | 3-4 weeks |
|---|
N-(2-aminophenyl)benzamide (CAS 721-47-1) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: N-(2-aminophenyl)benzamide. InChIKey: RFDVMOUXHKTCDO-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | N-(2-aminophenyl)benzamide |
| InChIKey | RFDVMOUXHKTCDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2N |
Computed by PubChem (NCBI)