cas: 2307737-94-4 — see every product listed under this CAS number, including other names
oxalic acid,N-(oxetan-3-yl)piperidin-4-amine, 97% (CAS 2307737-94-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch138NYI-100mg |
| cas | 2307737-94-4 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1024.40 Pln | |
| Chemat | 500mg | 1432.40 Pln | |
| Chemat | 1g | 2022.80 Pln | |
| Chemat | 5g | 5944.40 Pln | |
| Chemat | 10g | 10062.80 Pln | |
| Fluorochem | 100mg | 1174.60 Pln | |
| Fluorochem | 250mg | 1893.10 Pln | |
| Fluorochem | 500mg | 2663.66 Pln | |
| Fluorochem | 1g | 3736.20 Pln | |
| Fluorochem | 5g | 10837.87 Pln | |
| Fluorochem | 10g | 18376.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Oxalic acid;N-(oxetan-3-yl)piperidin-4-amine (CAS 2307737-94-4) is a chemical compound with the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. IUPAC name: oxalic acid;N-(oxetan-3-yl)piperidin-4-amine. InChIKey: KNWGXWFMFMDIFI-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O5 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | oxalic acid;N-(oxetan-3-yl)piperidin-4-amine |
| InChIKey | KNWGXWFMFMDIFI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NC2COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)