CAS 14650-26-1 appears in our catalog under these names: H–Asp(Leu–OH)–OH, b-Asp-Leu, >95% (HPLC), Beta-Asp-Leu, >95% (HPLC), H-Asp(Leu-OH)-OH, β-Asp-Leu. Offered by: GLPBio, TRC, Biosynth, MedChemExpress. Available pack sizes: 1g, 100mg, 10mg, 50mg, 250mg, 500mg, 1000mg, 2000mg.
Beta-Asp-Leu is a dipeptide that is the N-(L-beta-aspartyl) derivative of L-leucine. It has a role as a human urinary metabolite. It is functionally related to an aspartic acid and a leucine.
Source: ChEBI
| Molecular formula | C10H18N2O5 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (2S)-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]-4-methylpentanoic acid |
| InChIKey | IYJILWQAFPUBHP-BQBZGAKWSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)