CAS 13726-85-7 appears in our catalog under these names: Boc–Gln–OH, Boc-L-Gln-OH, tert-Butoxycarbonyl-L-glutamine, Nalpha-(tert-Butoxycarbonyl)-L-glutamine, >98.0%(HPLC)(T), Boc-Gln-OH, 98.00%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Chemat. Available pack sizes: 100g, 25g, 250g, 10g, 500g, 1000g, 5000g, 5g.
(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 13726-85-7) is a chemical compound with the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. IUPAC name: (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: VVNYDCGZZSTUBC-LURJTMIESA-N.
| Molecular formula | C10H18N2O5 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | VVNYDCGZZSTUBC-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)