Products 68567-47-5
CAS 68567-47-5 is the registry number for 2,4-Bis(acetylamino)-2,4,6-trideoxy-D-galactose. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg.
N-[(2R,3S,4S,5R)-4-acetamido-3,5-dihydroxy-1-oxohexan-2-yl]acetamide (CAS 68567-47-5) is a chemical compound with the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. IUPAC name: N-[(2R,3S,4S,5R)-4-acetamido-3,5-dihydroxy-1-oxohexan-2-yl]acetamide. InChIKey: RSSXUFPRJLLCMA-MYMYLCHPSA-N.
| Molecular formula | C10H18N2O5 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | N-[(2R,3S,4S,5R)-4-acetamido-3,5-dihydroxy-1-oxohexan-2-yl]acetamide |
| InChIKey | RSSXUFPRJLLCMA-MYMYLCHPSA-N |
| SMILES | C[C@H]([C@@H]([C@@H]([C@H](C=O)NC(=O)C)O)NC(=O)C)O |
Computed by PubChem (NCBI)