CAS 3062-14-4 appears in our catalog under these names: H-Asp-leu-oh, 95%, H-Asp-Leu-OH, >95% (HPLC), H–Asp–Leu–OH, H-Asp-Leu-OH, L-α-Aspartyl-L-leucine, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1g, 10mg, 50mg, 0,1g, 0,05g, 0,25g.
Alpha-Asp-Leu is a dipeptide that is the N-(L-alpha-aspartyl) derivative of L-leucine. It has a role as a human urinary metabolite. It is functionally related to an aspartic acid and a leucine.
Source: ChEBI
| Molecular formula | C10H18N2O5 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-4-methylpentanoic acid |
| InChIKey | ZVDPYSVOZFINEE-BQBZGAKWSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)