CAS 61348-28-5 appears in our catalog under these names: 5-Amino-2-((tert-butoxycarbonyl)amino)-5-oxopentanoic acid, 98.0%, N2-Boc-D-glutamine, Boc–D–Gln–OH, Boc-D-Gln-OH, N(alpha)-Boc-D-glutamine, 98+% . Offered by: MedChemExpress, TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar). Available pack sizes: 25 g, 100 g, 500 g, 5 g, 50 g, 10 g, 2,5g, 100g.
(2R)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 61348-28-5) is a chemical compound with the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. IUPAC name: (2R)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: VVNYDCGZZSTUBC-ZCFIWIBFSA-N.
| Molecular formula | C10H18N2O5 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (2R)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | VVNYDCGZZSTUBC-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)