CAS 336182-03-7 appears in our catalog under these names: Boc-l-beta-homoasparagine, 95%, Boc– ?–HoAsn–OH, Boc-L-beta-HAsn-OH, Boc-β-HoAsn-OH 97%, BOC-L-BETA-HOMOASPARAGINE, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 10G, 1g, 5g, 100mg.
(3S)-5-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 336182-03-7) is a chemical compound with the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. IUPAC name: (3S)-5-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: IUNRBHPDQJCDLT-LURJTMIESA-N.
| Molecular formula | C10H18N2O5 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (3S)-5-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | IUNRBHPDQJCDLT-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)