Products 1337842-14-4
CAS 1337842-14-4 appears in our catalog under these names: 5,6-dichlorobenzofuran-3-one, 97%, 97%, 5,6-dichloro-1-benzofuran-3-ol, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
5,6-dichloro-1-benzofuran-3-one (CAS 1337842-14-4) is a chemical compound with the molecular formula C8H4Cl2O2 and a molecular weight of 203.02 g/mol. IUPAC name: 5,6-dichloro-1-benzofuran-3-one. InChIKey: TYWASUUDIZEDGE-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2O2 |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 5,6-dichloro-1-benzofuran-3-one |
| InChIKey | TYWASUUDIZEDGE-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC(=C(C=C2O1)Cl)Cl |
Computed by PubChem (NCBI)